C4H6N2S2 — CID 55286715
5-imino-4-methyl-1,3-thiazolidine-2-thione (PubChem CID 55286715) has the molecular formula C4H6N2S2 and a molecular weight of 146.24 g/mol. Its IUPAC name is 5-imino-4-methyl-1,3-thiazolidine-2-thione.
| Compound Name | 5-imino-4-methyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 55286715 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 5-imino-4-methyl-1,3-thiazolidine-2-thione |
| SMILES | [H]/N=C1\SC(=S)NC1C |
| InChI | InChI=1S/C4H6N2S2/c1-2-3(5)8-4(7)6-2/h2,5H,1H3,(H,6,7)/b5-3- |
| InChIKey | YZCGFCIQLUHSSQ-HYXAFXHYSA-N |
| XLogP | 0.97 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|