C6H10N2OS — CID 121227390
5-imino-4-propyl-1,3-thiazolidin-2-one (PubChem CID 121227390) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 5-imino-4-propyl-1,3-thiazolidin-2-one.
| Compound Name | 5-imino-4-propyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 121227390 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 5-imino-4-propyl-1,3-thiazolidin-2-one |
| SMILES | [H]/N=C1\SC(=O)NC1CCC |
| InChI | InChI=1S/C6H10N2OS/c1-2-3-4-5(7)10-6(9)8-4/h4,7H,2-3H2,1H3,(H,8,9)/b7-5- |
| InChIKey | VJSURHMPIXMIEF-ALCCZGGFSA-N |
| XLogP | 1.59 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|