C6H9NO2S — CID 20513641
4-propyl-1,3-thiazolidine-2,5-dione (PubChem CID 20513641) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 4-propyl-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-propyl-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 20513641 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 4-propyl-1,3-thiazolidine-2,5-dione |
| SMILES | CCCC1NC(=O)SC1=O |
| InChI | InChI=1S/C6H9NO2S/c1-2-3-4-5(8)10-6(9)7-4/h4H,2-3H2,1H3,(H,7,9) |
| InChIKey | HITOHLNHKMZLCV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|