C4H5NS3 — CID 71323977
5-methyl-1,3-thiazolidine-2,4-dithione (PubChem CID 71323977) has the molecular formula C4H5NS3 and a molecular weight of 163.29 g/mol. Its IUPAC name is 5-methyl-1,3-thiazolidine-2,4-dithione.
| Compound Name | 5-methyl-1,3-thiazolidine-2,4-dithione |
|---|---|
| PubChem CID | 71323977 |
| Molecular Formula | C4H5NS3 |
| Molecular Weight | 163.29 g/mol |
| Exact Mass | 162.96 |
| IUPAC Name | 5-methyl-1,3-thiazolidine-2,4-dithione |
| SMILES | CC1SC(=S)NC1=S |
| InChI | InChI=1S/C4H5NS3/c1-2-3(6)5-4(7)8-2/h2H,1H3,(H,5,6,7) |
| InChIKey | RKLLXHCROVICJL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|