C8H8N2O2S4 — CID 40559857
(5S)-5-[1-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 40559857) has the molecular formula C8H8N2O2S4 and a molecular weight of 292.43 g/mol. Its IUPAC name is (5S)-5-[1-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[1-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40559857 |
| Molecular Formula | C8H8N2O2S4 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | (5S)-5-[1-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC([C@@H]1SC(=S)NC1=O)[C@@H]1SC(=S)NC1=O |
| InChI | InChI=1S/C8H8N2O2S4/c1-2(3-5(11)9-7(13)15-3)4-6(12)10-8(14)16-4/h2-4H,1H3,(H,9,11,13)(H,10,12,14)/t3-,4-/m0/s1 |
| InChIKey | CAXCSMMWQXAWSL-IMJSIDKUSA-N |
| XLogP | 0.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|