C17H20N2O3S2 — CID 98389969
N-[2,6-di(propan-2-yl)phenyl]-2-oxo-2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide (PubChem CID 98389969) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-oxo-2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-oxo-2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 98389969 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-oxo-2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C(=O)[C@@H]1SC(=S)NC1=O |
| InChI | InChI=1S/C17H20N2O3S2/c1-8(2)10-6-5-7-11(9(3)4)12(10)18-15(21)13(20)14-16(22)19-17(23)24-14/h5-9,14H,1-4H3,(H,18,21)(H,19,22,23)/t14-/m0/s1 |
| InChIKey | YRBVWJLJJHQCID-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|