C28H37NO2 — CID 175835841
3,4-bis[2,6-di(propan-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 175835841) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 3,4-bis[2,6-di(propan-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3,4-bis[2,6-di(propan-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175835841 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 3,4-bis[2,6-di(propan-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1C1C(=O)NC(=O)C1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H37NO2/c1-15(2)19-11-9-12-20(16(3)4)23(19)25-26(28(31)29-27(25)30)24-21(17(5)6)13-10-14-22(24)18(7)8/h9-18,25-26H,1-8H3,(H,29,30,31) |
| InChIKey | UHSZKSBQOSJHAQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|