C7H12N2O2S — CID 173496185
2-(hydroxymethylimino)-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 173496185) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-(hydroxymethylimino)-5-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-(hydroxymethylimino)-5-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173496185 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(hydroxymethylimino)-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1SC(=NCO)NC1=O |
| InChI | InChI=1S/C7H12N2O2S/c1-4(2)5-6(11)9-7(12-5)8-3-10/h4-5,10H,3H2,1-2H3,(H,8,9,11) |
| InChIKey | MKJHYTPLUYWUTJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|