C12H22N2OS — CID 135989472
2-[(2S)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 135989472) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-[(2S)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2S)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989472 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(2S)-3,3-dimethylbutan-2-yl]imino-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1S/C(=N\[C@@H](C)C(C)(C)C)NC1=O |
| InChI | InChI=1S/C12H22N2OS/c1-7(2)9-10(15)14-11(16-9)13-8(3)12(4,5)6/h7-9H,1-6H3,(H,13,14,15)/t8-,9?/m0/s1 |
| InChIKey | RJQDZJYTXDFKMY-IENPIDJESA-N |
| XLogP | 2.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|