C14H31N2OPS — CID 143146987
diethylphosphane;ethane;2-ethylimino-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 143146987) has the molecular formula C14H31N2OPS and a molecular weight of 306.46 g/mol. Its IUPAC name is diethylphosphane;ethane;2-ethylimino-5-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | diethylphosphane;ethane;2-ethylimino-5-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143146987 |
| Molecular Formula | C14H31N2OPS |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | diethylphosphane;ethane;2-ethylimino-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC.CC/N=C1/NC(=O)C(C(C)C)S1.CCPCC |
| InChI | InChI=1S/C8H14N2OS.C4H11P.C2H6/c1-4-9-8-10-7(11)6(12-8)5(2)3;1-3-5-4-2;1-2/h5-6H,4H2,1-3H3,(H,9,10,11);5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | SPWFUPVVKBAZSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|