C21H28N2O3S2 — CID 135989847
2-[[4-(4-methylsulfonylphenyl)-1-bicyclo[2.2.2]octanyl]imino]-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 135989847) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-[[4-(4-methylsulfonylphenyl)-1-bicyclo[2.2.2]octanyl]imino]-5-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-(4-methylsulfonylphenyl)-1-bicyclo[2.2.2]octanyl]imino]-5-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989847 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[[4-(4-methylsulfonylphenyl)-1-bicyclo[2.2.2]octanyl]imino]-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1S/C(=N\C23CCC(c4ccc(S(C)(=O)=O)cc4)(CC2)CC3)NC1=O |
| InChI | InChI=1S/C21H28N2O3S2/c1-14(2)17-18(24)22-19(27-17)23-21-11-8-20(9-12-21,10-13-21)15-4-6-16(7-5-15)28(3,25)26/h4-7,14,17H,8-13H2,1-3H3,(H,22,23,24) |
| InChIKey | ICWKDMCNQSFMPU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|