C10H10ClN3S2 — CID 91219786
5-(4-chlorophenyl)-6-imino-3-methyl-1,3,4-thiadiazinane-2-thione (PubChem CID 91219786) has the molecular formula C10H10ClN3S2 and a molecular weight of 271.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6-imino-3-methyl-1,3,4-thiadiazinane-2-thione.
| Compound Name | 5-(4-chlorophenyl)-6-imino-3-methyl-1,3,4-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 91219786 |
| Molecular Formula | C10H10ClN3S2 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 5-(4-chlorophenyl)-6-imino-3-methyl-1,3,4-thiadiazinane-2-thione |
| SMILES | [H]/N=C1\SC(=S)N(C)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10ClN3S2/c1-14-10(15)16-9(12)8(13-14)6-2-4-7(11)5-3-6/h2-5,8,12-13H,1H3/b12-9- |
| InChIKey | IPZNUGBSPZLCEI-XFXZXTDPSA-N |
| XLogP | 2.83 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|