C15H13Cl2N3S — CID 13127002
4,6-bis(4-chlorophenyl)-1,3,5-triazinane-2-thione (PubChem CID 13127002) has the molecular formula C15H13Cl2N3S and a molecular weight of 338.26 g/mol. Its IUPAC name is 4,6-bis(4-chlorophenyl)-1,3,5-triazinane-2-thione.
| Compound Name | 4,6-bis(4-chlorophenyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 13127002 |
| Molecular Formula | C15H13Cl2N3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4,6-bis(4-chlorophenyl)-1,3,5-triazinane-2-thione |
| SMILES | S=C1NC(c2ccc(Cl)cc2)NC(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C15H13Cl2N3S/c16-11-5-1-9(2-6-11)13-18-14(20-15(21)19-13)10-3-7-12(17)8-4-10/h1-8,13-14,18H,(H2,19,20,21) |
| InChIKey | CQVWZSGZICHECO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|