C14H17ClN2O2 — CID 6401381
(2S,5E)-2-(4-chlorophenyl)-5-hydroxyimino-1,3,3-trimethylpiperidin-4-one (PubChem CID 6401381) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is (2S,5E)-2-(4-chlorophenyl)-5-hydroxyimino-1,3,3-trimethylpiperidin-4-one.
| Compound Name | (2S,5E)-2-(4-chlorophenyl)-5-hydroxyimino-1,3,3-trimethylpiperidin-4-one |
|---|---|
| PubChem CID | 6401381 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2S,5E)-2-(4-chlorophenyl)-5-hydroxyimino-1,3,3-trimethylpiperidin-4-one |
| SMILES | CN1C/C(=N\O)C(=O)C(C)(C)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-14(2)12(9-4-6-10(15)7-5-9)17(3)8-11(16-19)13(14)18/h4-7,12,19H,8H2,1-3H3/b16-11+/t12-/m0/s1 |
| InChIKey | CGCKJOWMULNGNN-JASJWYONSA-N |
| XLogP | 2.75 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|