C13H16ClNO2 — CID 597249
2-(4-chlorophenyl)-5-hydroxy-1,5-dimethylpiperidin-4-one (PubChem CID 597249) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-hydroxy-1,5-dimethylpiperidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-5-hydroxy-1,5-dimethylpiperidin-4-one |
|---|---|
| PubChem CID | 597249 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5-hydroxy-1,5-dimethylpiperidin-4-one |
| SMILES | CN1CC(C)(O)C(=O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO2/c1-13(17)8-15(2)11(7-12(13)16)9-3-5-10(14)6-4-9/h3-6,11,17H,7-8H2,1-2H3 |
| InChIKey | YMBUJBMVBLPSPL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |