C14H17ClN2O2 — CID 11055088
(2R,4R,5R)-2-(4-chlorophenyl)-4,5-dihydroxy-1,5-dimethylpiperidine-4-carbonitrile (PubChem CID 11055088) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is (2R,4R,5R)-2-(4-chlorophenyl)-4,5-dihydroxy-1,5-dimethylpiperidine-4-carbonitrile.
| Compound Name | (2R,4R,5R)-2-(4-chlorophenyl)-4,5-dihydroxy-1,5-dimethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 11055088 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2R,4R,5R)-2-(4-chlorophenyl)-4,5-dihydroxy-1,5-dimethylpiperidine-4-carbonitrile |
| SMILES | CN1C[C@@](C)(O)[C@](O)(C#N)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-13(18)9-17(2)12(7-14(13,19)8-16)10-3-5-11(15)6-4-10/h3-6,12,18-19H,7,9H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | LPJGBHDHYRMGJV-MGPQQGTHSA-N |
| XLogP | 1.72 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|