C15H20ClNO — CID 138641914
6-(4-chlorophenyl)-3-methyl-1-propylpiperidin-2-one (PubChem CID 138641914) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-methyl-1-propylpiperidin-2-one.
| Compound Name | 6-(4-chlorophenyl)-3-methyl-1-propylpiperidin-2-one |
|---|---|
| PubChem CID | 138641914 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 6-(4-chlorophenyl)-3-methyl-1-propylpiperidin-2-one |
| SMILES | CCCN1C(=O)C(C)CCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO/c1-3-10-17-14(9-4-11(2)15(17)18)12-5-7-13(16)8-6-12/h5-8,11,14H,3-4,9-10H2,1-2H3 |
| InChIKey | IJMCLFKKHWDCNO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |