C19H26ClNO2 — CID 138641954
(3R)-6-(4-chlorophenyl)-1-(1-methoxybutan-2-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 138641954) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is (3R)-6-(4-chlorophenyl)-1-(1-methoxybutan-2-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R)-6-(4-chlorophenyl)-1-(1-methoxybutan-2-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 138641954 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3R)-6-(4-chlorophenyl)-1-(1-methoxybutan-2-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1CCC(c2ccc(Cl)cc2)N(C(CC)COC)C1=O |
| InChI | InChI=1S/C19H26ClNO2/c1-4-6-15-9-12-18(14-7-10-16(20)11-8-14)21(19(15)22)17(5-2)13-23-3/h4,7-8,10-11,15,17-18H,1,5-6,9,12-13H2,2-3H3/t15-,17?,18?/m0/s1 |
| InChIKey | ILODYLSVENEDQB-ZLPCBKJTSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|