C22H32ClNOS — CID 144758098
6-(4-chlorophenyl)-1-(3-methyl-1-propan-2-ylsulfanylbutan-2-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 144758098) has the molecular formula C22H32ClNOS and a molecular weight of 394.02 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-(3-methyl-1-propan-2-ylsulfanylbutan-2-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | 6-(4-chlorophenyl)-1-(3-methyl-1-propan-2-ylsulfanylbutan-2-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 144758098 |
| Molecular Formula | C22H32ClNOS |
| Molecular Weight | 394.02 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-(4-chlorophenyl)-1-(3-methyl-1-propan-2-ylsulfanylbutan-2-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1CCC(c2ccc(Cl)cc2)N(C(CSC(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C22H32ClNOS/c1-6-7-18-10-13-20(17-8-11-19(23)12-9-17)24(22(18)25)21(15(2)3)14-26-16(4)5/h6,8-9,11-12,15-16,18,20-21H,1,7,10,13-14H2,2-5H3 |
| InChIKey | MWIIMQBQKROFJD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.02 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|