C22H30ClNO2 — CID 138641449
6-(4-chlorophenyl)-1-(7-oxooctan-3-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 138641449) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-(7-oxooctan-3-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | 6-(4-chlorophenyl)-1-(7-oxooctan-3-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 138641449 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 6-(4-chlorophenyl)-1-(7-oxooctan-3-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1CCC(c2ccc(Cl)cc2)N(C(CC)CCCC(C)=O)C1=O |
| InChI | InChI=1S/C22H30ClNO2/c1-4-7-18-12-15-21(17-10-13-19(23)14-11-17)24(22(18)26)20(5-2)9-6-8-16(3)25/h4,10-11,13-14,18,20-21H,1,5-9,12,15H2,2-3H3 |
| InChIKey | YPPAWQVITDWPJF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|