C20H28ClNOS — CID 138641588
(3R)-6-(4-chlorophenyl)-1-[(2S)-1-ethylsulfanylbutan-2-yl]-3-prop-2-enylpiperidin-2-one (PubChem CID 138641588) has the molecular formula C20H28ClNOS and a molecular weight of 365.97 g/mol. Its IUPAC name is (3R)-6-(4-chlorophenyl)-1-[(2S)-1-ethylsulfanylbutan-2-yl]-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R)-6-(4-chlorophenyl)-1-[(2S)-1-ethylsulfanylbutan-2-yl]-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 138641588 |
| Molecular Formula | C20H28ClNOS |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (3R)-6-(4-chlorophenyl)-1-[(2S)-1-ethylsulfanylbutan-2-yl]-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1CCC(c2ccc(Cl)cc2)N([C@@H](CC)CSCC)C1=O |
| InChI | InChI=1S/C20H28ClNOS/c1-4-7-16-10-13-19(15-8-11-17(21)12-9-15)22(20(16)23)18(5-2)14-24-6-3/h4,8-9,11-12,16,18-19H,1,5-7,10,13-14H2,2-3H3/t16-,18-,19?/m0/s1 |
| InChIKey | OWVJWYTZVKBWIJ-SPIBDARASA-N |
| XLogP | 5.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|