C9H15NSe — CID 143912714
(4E,5E)-5-ethylidene-2-methyl-4-propylidene-1,3-selenazolidine (PubChem CID 143912714) has the molecular formula C9H15NSe and a molecular weight of 216.19 g/mol. Its IUPAC name is (4E,5E)-5-ethylidene-2-methyl-4-propylidene-1,3-selenazolidine.
| Compound Name | (4E,5E)-5-ethylidene-2-methyl-4-propylidene-1,3-selenazolidine |
|---|---|
| PubChem CID | 143912714 |
| Molecular Formula | C9H15NSe |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (4E,5E)-5-ethylidene-2-methyl-4-propylidene-1,3-selenazolidine |
| SMILES | C/C=C1/[Se]C(C)N/C1=C/CC |
| InChI | InChI=1S/C9H15NSe/c1-4-6-8-9(5-2)11-7(3)10-8/h5-7,10H,4H2,1-3H3/b8-6+,9-5+ |
| InChIKey | SUWCUVFSECNKQQ-RFSWUZDDSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|