C9H13NS2 — CID 45098963
(1R,5S,8R)-1,8-dimethyl-3-azabicyclo[3.2.1]octane-2,4-dithione (PubChem CID 45098963) has the molecular formula C9H13NS2 and a molecular weight of 199.34 g/mol. Its IUPAC name is (1R,5S,8R)-1,8-dimethyl-3-azabicyclo[3.2.1]octane-2,4-dithione.
| Compound Name | (1R,5S,8R)-1,8-dimethyl-3-azabicyclo[3.2.1]octane-2,4-dithione |
|---|---|
| PubChem CID | 45098963 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (1R,5S,8R)-1,8-dimethyl-3-azabicyclo[3.2.1]octane-2,4-dithione |
| SMILES | C[C@@H]1[C@@H]2CC[C@@]1(C)C(=S)NC2=S |
| InChI | InChI=1S/C9H13NS2/c1-5-6-3-4-9(5,2)8(12)10-7(6)11/h5-6H,3-4H2,1-2H3,(H,10,11,12)/t5-,6+,9-/m1/s1 |
| InChIKey | XAAZHSUGIQNGKZ-QIOHGKGESA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|