C10H17NO — CID 88656735
(NZ)-N-(1,4-dimethyl-8-bicyclo[3.2.1]octanylidene)hydroxylamine (PubChem CID 88656735) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (NZ)-N-(1,4-dimethyl-8-bicyclo[3.2.1]octanylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1,4-dimethyl-8-bicyclo[3.2.1]octanylidene)hydroxylamine |
|---|---|
| PubChem CID | 88656735 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (NZ)-N-(1,4-dimethyl-8-bicyclo[3.2.1]octanylidene)hydroxylamine |
| SMILES | CC1CCC2(C)CCC1/C2=N/O |
| InChI | InChI=1S/C10H17NO/c1-7-3-5-10(2)6-4-8(7)9(10)11-12/h7-8,12H,3-6H2,1-2H3/b11-9- |
| InChIKey | FOJLTBDXSPNFCK-LUAWRHEFSA-N |
| XLogP | 2.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|