C15H27NO — CID 134174397
(NZ)-N-(3,3-dimethyl-2,4a,5,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-4-ylidene)hydroxylamine (PubChem CID 134174397) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (NZ)-N-(3,3-dimethyl-2,4a,5,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(3,3-dimethyl-2,4a,5,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 134174397 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (NZ)-N-(3,3-dimethyl-2,4a,5,6,7,8,9,10,11,11a-decahydro-1H-benzo[9]annulen-4-ylidene)hydroxylamine |
| SMILES | CC1(C)CCC2CCCCCCCC2/C1=N/O |
| InChI | InChI=1S/C15H27NO/c1-15(2)11-10-12-8-6-4-3-5-7-9-13(12)14(15)16-17/h12-13,17H,3-11H2,1-2H3/b16-14- |
| InChIKey | UZELWCQDXIUREX-PEZBUJJGSA-N |
| XLogP | 4.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|