C10H16BrNOSe — CID 10903459
[(1S,2S,3E,4R)-3-hydroxyimino-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] selenohypobromite (PubChem CID 10903459) has the molecular formula C10H16BrNOSe and a molecular weight of 325.11 g/mol. Its IUPAC name is [(1S,2S,3E,4R)-3-hydroxyimino-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] selenohypobromite.
| Compound Name | [(1S,2S,3E,4R)-3-hydroxyimino-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] selenohypobromite |
|---|---|
| PubChem CID | 10903459 |
| Molecular Formula | C10H16BrNOSe |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | [(1S,2S,3E,4R)-3-hydroxyimino-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] selenohypobromite |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N\O)[C@H]2[Se]Br |
| InChI | InChI=1S/C10H16BrNOSe/c1-9(2)6-4-5-10(9,3)8(12-13)7(6)14-11/h6-7,13H,4-5H2,1-3H3/b12-8-/t6-,7+,10+/m1/s1 |
| InChIKey | RCYKEEJOOVVJKG-HWZZAZAHSA-N |
| XLogP | 3.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|