C15H21N2O+ — CID 3847818
N-(1,7,7-trimethyl-3-pyridin-1-ium-1-yl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine (PubChem CID 3847818) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(1,7,7-trimethyl-3-pyridin-1-ium-1-yl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine.
| Compound Name | N-(1,7,7-trimethyl-3-pyridin-1-ium-1-yl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine |
|---|---|
| PubChem CID | 3847818 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-(1,7,7-trimethyl-3-pyridin-1-ium-1-yl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine |
| SMILES | CC12CCC(C([n+]3ccccc3)C1=NO)C2(C)C |
| InChI | InChI=1S/C15H20N2O/c1-14(2)11-7-8-15(14,3)13(16-18)12(11)17-9-5-4-6-10-17/h4-6,9-12H,7-8H2,1-3H3/p+1 |
| InChIKey | GOJSQMBDTXKYPT-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|