C23H17FN4O6 — CID 1307756
3-[(2-fluorophenyl)methyl]-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 1307756) has the molecular formula C23H17FN4O6 and a molecular weight of 464.41 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-[(2-fluorophenyl)methyl]-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1307756 |
| Molecular Formula | C23H17FN4O6 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-5-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | COc1cc(C=C2NC(=O)N(Cc3ccccc3F)C2=O)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H17FN4O6/c1-33-20-11-14(6-8-19(20)34-21-9-7-16(12-25-21)28(31)32)10-18-22(29)27(23(30)26-18)13-15-4-2-3-5-17(15)24/h2-12H,13H2,1H3,(H,26,30) |
| InChIKey | ZECYQUDVMGWXCH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|