C14H7NO3S — CID 13077713
14-oxa-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-15,16-dione (PubChem CID 13077713) has the molecular formula C14H7NO3S and a molecular weight of 269.28 g/mol. Its IUPAC name is 14-oxa-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-15,16-dione.
| Compound Name | 14-oxa-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-15,16-dione |
|---|---|
| PubChem CID | 13077713 |
| Molecular Formula | C14H7NO3S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 14-oxa-8-thia-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaene-15,16-dione |
| SMILES | O=c1oc2cccc3c2n(c1=O)-c1ccccc1S3 |
| InChI | InChI=1S/C14H7NO3S/c16-13-14(17)18-9-5-3-7-11-12(9)15(13)8-4-1-2-6-10(8)19-11/h1-7H |
| InChIKey | PXZHQCRPEPRNPR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|