C13H8N2S2 — CID 165356082
8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-15-thione (PubChem CID 165356082) has the molecular formula C13H8N2S2 and a molecular weight of 256.36 g/mol. Its IUPAC name is 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-15-thione.
| Compound Name | 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-15-thione |
|---|---|
| PubChem CID | 165356082 |
| Molecular Formula | C13H8N2S2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 8-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16)-hexaene-15-thione |
| SMILES | S=c1[nH]c2cccc3c2n1-c1ccccc1S3 |
| InChI | InChI=1S/C13H8N2S2/c16-13-14-8-4-3-7-11-12(8)15(13)9-5-1-2-6-10(9)17-11/h1-7H,(H,14,16) |
| InChIKey | MTVFGCTVNHPRKE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|