C10H13IN2OS — CID 130783846
3-iodo-N-[(1-methylazetidin-3-yl)methyl]thiophene-2-carboxamide (PubChem CID 130783846) has the molecular formula C10H13IN2OS and a molecular weight of 336.20 g/mol. Its IUPAC name is 3-iodo-N-[(1-methylazetidin-3-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-iodo-N-[(1-methylazetidin-3-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130783846 |
| Molecular Formula | C10H13IN2OS |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-iodo-N-[(1-methylazetidin-3-yl)methyl]thiophene-2-carboxamide |
| SMILES | CN1CC(CNC(=O)c2sccc2I)C1 |
| InChI | InChI=1S/C10H13IN2OS/c1-13-5-7(6-13)4-12-10(14)9-8(11)2-3-15-9/h2-3,7H,4-6H2,1H3,(H,12,14) |
| InChIKey | PUOWFCMMYQGMMU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|