C8H7F3INOS — CID 130805140
3-iodo-N-(1,1,1-trifluoropropan-2-yl)thiophene-2-carboxamide (PubChem CID 130805140) has the molecular formula C8H7F3INOS and a molecular weight of 349.12 g/mol. Its IUPAC name is 3-iodo-N-(1,1,1-trifluoropropan-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-iodo-N-(1,1,1-trifluoropropan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130805140 |
| Molecular Formula | C8H7F3INOS |
| Molecular Weight | 349.12 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 3-iodo-N-(1,1,1-trifluoropropan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1sccc1I)C(F)(F)F |
| InChI | InChI=1S/C8H7F3INOS/c1-4(8(9,10)11)13-7(14)6-5(12)2-3-15-6/h2-4H,1H3,(H,13,14) |
| InChIKey | PWGADLRZHMPMFQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|