About 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide
4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 122559242) has the molecular formula C15H13F3N2O2S
and a molecular weight of 342.34 g/mol. Its IUPAC name is 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
| PubChem CID | 122559242 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(-c2csc(C(N)=O)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O2S/c1-8(15(16,17)18)20-14(22)10-4-2-9(3-5-10)11-6-12(13(19)21)23-7-11/h2-8H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | FTPPVPULOGZKFU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide?
The IUPAC name of 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide (CID 122559242) is 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide.
What is the SMILES notation for 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide?
The canonical SMILES for 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide is CC(NC(=O)c1ccc(-c2csc(C(N)=O)c2)cc1)C(F)(F)F.
What is the InChIKey of 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide?
The InChIKey is FTPPVPULOGZKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O2S/c1-8(15(16,17)18)20-14(22)10-4-2-9(3-5-10)11-6-12(13(19)21)23-7-11/h2-8H,1H3,(H2,19,21)(H,20,22).
What are the key properties of 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide?
4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide has a molecular weight of 342.34 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 122559242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).