2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid

C9H4BrIO2S — CID 130792421

IUPAC2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid
SMILESO=C(O)c1cc(I)c2sc(Br)cc2c1
InChIInChI=1S/C9H4BrIO2S/c10-7-3-4-1-5(9(12)13)2-6(11)8(4)14-7/h1-3H,(H,12,13)
InChIKeyITNQVHSTPQHRQE-UHFFFAOYSA-N
MW383.00 g/mol
LogP3.97
Rot. Bonds1

About 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid

2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid (PubChem CID 130792421) has the molecular formula C9H4BrIO2S and a molecular weight of 383.00 g/mol. Its IUPAC name is 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid.

Molecular Properties

Compound Name2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid
PubChem CID130792421
Molecular FormulaC9H4BrIO2S
Molecular Weight383.00 g/mol
Exact Mass381.82
IUPAC Name2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid
SMILESO=C(O)c1cc(I)c2sc(Br)cc2c1
InChIInChI=1S/C9H4BrIO2S/c10-7-3-4-1-5(9(12)13)2-6(11)8(4)14-7/h1-3H,(H,12,13)
InChIKeyITNQVHSTPQHRQE-UHFFFAOYSA-N
XLogP3.97
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500383.00
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid?
The IUPAC name of 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid (CID 130792421) is 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid.
What is the SMILES notation for 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid?
The canonical SMILES for 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid is O=C(O)c1cc(I)c2sc(Br)cc2c1.
What is the InChIKey of 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid?
The InChIKey is ITNQVHSTPQHRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrIO2S/c10-7-3-4-1-5(9(12)13)2-6(11)8(4)14-7/h1-3H,(H,12,13).
What are the key properties of 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid?
2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid has a molecular weight of 383.00 g/mol, XLogP of 3.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-7-iodo-1-benzothiophene-5-carboxylic acid is sourced from PubChem (CID 130792421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).