C9H6BrNO2S — CID 130792934
2-bromo-1-(2-sulfanylidene-3H-1,3-benzoxazol-7-yl)ethanone (PubChem CID 130792934) has the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. Its IUPAC name is 2-bromo-1-(2-sulfanylidene-3H-1,3-benzoxazol-7-yl)ethanone.
| Compound Name | 2-bromo-1-(2-sulfanylidene-3H-1,3-benzoxazol-7-yl)ethanone |
|---|---|
| PubChem CID | 130792934 |
| Molecular Formula | C9H6BrNO2S |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 270.93 |
| IUPAC Name | 2-bromo-1-(2-sulfanylidene-3H-1,3-benzoxazol-7-yl)ethanone |
| SMILES | O=C(CBr)c1cccc2[nH]c(=S)oc12 |
| InChI | InChI=1S/C9H6BrNO2S/c10-4-7(12)5-2-1-3-6-8(5)13-9(14)11-6/h1-3H,4H2,(H,11,14) |
| InChIKey | INKBACPJPYCLNB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|