C8H6ClNOS — CID 131216690
7-(chloromethyl)-3H-1,3-benzoxazole-2-thione (PubChem CID 131216690) has the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. Its IUPAC name is 7-(chloromethyl)-3H-1,3-benzoxazole-2-thione.
| Compound Name | 7-(chloromethyl)-3H-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 131216690 |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 7-(chloromethyl)-3H-1,3-benzoxazole-2-thione |
| SMILES | S=c1[nH]c2cccc(CCl)c2o1 |
| InChI | InChI=1S/C8H6ClNOS/c9-4-5-2-1-3-6-7(5)11-8(12)10-6/h1-3H,4H2,(H,10,12) |
| InChIKey | DAVCJTDDZANILT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|