C8H3F4NOS — CID 150480269
7-fluoro-6-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione (PubChem CID 150480269) has the molecular formula C8H3F4NOS and a molecular weight of 237.18 g/mol. Its IUPAC name is 7-fluoro-6-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione.
| Compound Name | 7-fluoro-6-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 150480269 |
| Molecular Formula | C8H3F4NOS |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 7-fluoro-6-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione |
| SMILES | Fc1c(C(F)(F)F)ccc2[nH]c(=S)oc12 |
| InChI | InChI=1S/C8H3F4NOS/c9-5-3(8(10,11)12)1-2-4-6(5)14-7(15)13-4/h1-2H,(H,13,15) |
| InChIKey | HTRFOBYOGQPXPT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|