C9H16ClNO2 — CID 130802714
2-chloro-1-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]propan-1-one (PubChem CID 130802714) has the molecular formula C9H16ClNO2 and a molecular weight of 205.69 g/mol. Its IUPAC name is 2-chloro-1-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 130802714 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-chloro-1-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1C[C@@H](C)C[C@@H](O)C1 |
| InChI | InChI=1S/C9H16ClNO2/c1-6-3-8(12)5-11(4-6)9(13)7(2)10/h6-8,12H,3-5H2,1-2H3/t6-,7?,8+/m0/s1 |
| InChIKey | DJXLJLXMQWMUES-YPVSKDHRSA-N |
| XLogP | 0.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|