C10H17NO4 — CID 130943626
3-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]-2-methyl-3-oxopropanoic acid (PubChem CID 130943626) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 130943626 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-[(3R,5S)-3-hydroxy-5-methylpiperidin-1-yl]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1C[C@@H](C)C[C@@H](O)C1 |
| InChI | InChI=1S/C10H17NO4/c1-6-3-8(12)5-11(4-6)9(13)7(2)10(14)15/h6-8,12H,3-5H2,1-2H3,(H,14,15)/t6-,7?,8+/m0/s1 |
| InChIKey | XSXOPNPPKSZDRK-YPVSKDHRSA-N |
| XLogP | -0.06 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|