C10H19NOS — CID 130802830
(3S,5R)-5-methyl-1-[2-(sulfanylmethyl)prop-2-enyl]piperidin-3-ol (PubChem CID 130802830) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is (3S,5R)-5-methyl-1-[2-(sulfanylmethyl)prop-2-enyl]piperidin-3-ol.
| Compound Name | (3S,5R)-5-methyl-1-[2-(sulfanylmethyl)prop-2-enyl]piperidin-3-ol |
|---|---|
| PubChem CID | 130802830 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (3S,5R)-5-methyl-1-[2-(sulfanylmethyl)prop-2-enyl]piperidin-3-ol |
| SMILES | C=C(CS)CN1C[C@H](C)C[C@H](O)C1 |
| InChI | InChI=1S/C10H19NOS/c1-8-3-10(12)6-11(4-8)5-9(2)7-13/h8,10,12-13H,2-7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | BVXRKDJRWCKSOY-SCZZXKLOSA-N |
| XLogP | 1.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|