C9H8F2N2S — CID 130803243
7-(difluoromethyl)-1-benzothiophene-2,4-diamine (PubChem CID 130803243) has the molecular formula C9H8F2N2S and a molecular weight of 214.24 g/mol. Its IUPAC name is 7-(difluoromethyl)-1-benzothiophene-2,4-diamine.
| Compound Name | 7-(difluoromethyl)-1-benzothiophene-2,4-diamine |
|---|---|
| PubChem CID | 130803243 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 7-(difluoromethyl)-1-benzothiophene-2,4-diamine |
| SMILES | Nc1cc2c(N)ccc(C(F)F)c2s1 |
| InChI | InChI=1S/C9H8F2N2S/c10-9(11)4-1-2-6(12)5-3-7(13)14-8(4)5/h1-3,9H,12-13H2 |
| InChIKey | MRFAJOZFBZNDHJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|