C10H19NOS — CID 130804463
2-(2-sulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130804463) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 2-(2-sulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-(2-sulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130804463 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-(2-sulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(CCS)CC2C1 |
| InChI | InChI=1S/C10H19NOS/c12-10-2-1-8-6-11(3-4-13)7-9(8)5-10/h8-10,12-13H,1-7H2 |
| InChIKey | QFXCVAQHVIUXAE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|