C10H17NO2S — CID 130857469
1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-sulfanylethanone (PubChem CID 130857469) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-sulfanylethanone.
| Compound Name | 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 130857469 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-sulfanylethanone |
| SMILES | O=C(CS)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C10H17NO2S/c12-9-2-1-7-4-11(10(13)6-14)5-8(7)3-9/h7-9,12,14H,1-6H2 |
| InChIKey | WIQSAWOZEMKMDV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|