C11H21NOS — CID 130987266
2-(3-sulfanylpropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130987266) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is 2-(3-sulfanylpropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-(3-sulfanylpropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130987266 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(3-sulfanylpropyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(CCCS)CC2C1 |
| InChI | InChI=1S/C11H21NOS/c13-11-3-2-9-7-12(4-1-5-14)8-10(9)6-11/h9-11,13-14H,1-8H2 |
| InChIKey | NTQOWVXYGCMCND-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|