C9H14N2O — CID 130804517
5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonitrile (PubChem CID 130804517) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonitrile.
| Compound Name | 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 130804517 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonitrile |
| SMILES | N#CN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C9H14N2O/c10-6-11-4-7-1-2-9(12)3-8(7)5-11/h7-9,12H,1-5H2 |
| InChIKey | YTZSWEBFSROYAC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|