C11H21NOS — CID 130915039
2-(2-methylsulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130915039) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is 2-(2-methylsulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-(2-methylsulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130915039 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(2-methylsulfanylethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CSCCN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C11H21NOS/c1-14-5-4-12-7-9-2-3-11(13)6-10(9)8-12/h9-11,13H,2-8H2,1H3 |
| InChIKey | VPIABDZYPCFRAS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |