C9H17NO2S — CID 130913965
2-methylsulfinyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130913965) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-methylsulfinyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-methylsulfinyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130913965 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 2-methylsulfinyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CS(=O)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C9H17NO2S/c1-13(12)10-5-7-2-3-9(11)4-8(7)6-10/h7-9,11H,2-6H2,1H3 |
| InChIKey | CDBMHEGVMQOGGX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |