C10H18F2N2 — CID 130806262
1-cyclobutyl-2-(3,3-difluoropyrrolidin-1-yl)ethanamine (PubChem CID 130806262) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is 1-cyclobutyl-2-(3,3-difluoropyrrolidin-1-yl)ethanamine.
| Compound Name | 1-cyclobutyl-2-(3,3-difluoropyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 130806262 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-cyclobutyl-2-(3,3-difluoropyrrolidin-1-yl)ethanamine |
| SMILES | NC(CN1CCC(F)(F)C1)C1CCC1 |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)4-5-14(7-10)6-9(13)8-2-1-3-8/h8-9H,1-7,13H2 |
| InChIKey | VOOYRWHKZLXUBL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |