C9H12F3N5O — CID 130815163
2,2,2-trifluoro-N-[4-(triazol-1-yl)piperidin-3-yl]acetamide (PubChem CID 130815163) has the molecular formula C9H12F3N5O and a molecular weight of 263.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(triazol-1-yl)piperidin-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(triazol-1-yl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 130815163 |
| Molecular Formula | C9H12F3N5O |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(triazol-1-yl)piperidin-3-yl]acetamide |
| SMILES | O=C(NC1CNCCC1n1ccnn1)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N5O/c10-9(11,12)8(18)15-6-5-13-2-1-7(6)17-4-3-14-16-17/h3-4,6-7,13H,1-2,5H2,(H,15,18) |
| InChIKey | VBMZXXYDWVMVDH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |