C7H12N4O2S — CID 130816027
N-[(2-methyltriazol-4-yl)methyl]-1,1-dioxothietan-3-amine (PubChem CID 130816027) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is N-[(2-methyltriazol-4-yl)methyl]-1,1-dioxothietan-3-amine.
| Compound Name | N-[(2-methyltriazol-4-yl)methyl]-1,1-dioxothietan-3-amine |
|---|---|
| PubChem CID | 130816027 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-[(2-methyltriazol-4-yl)methyl]-1,1-dioxothietan-3-amine |
| SMILES | Cn1ncc(CNC2CS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C7H12N4O2S/c1-11-9-3-6(10-11)2-8-7-4-14(12,13)5-7/h3,7-8H,2,4-5H2,1H3 |
| InChIKey | CZPYSXAZLQKXQC-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |